CAS 929973-61-5 is the registry number for 2-Chloro-N-{4-((difluoromethyl)sulfanyl)phenyl}propanamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-N-[4-(difluoromethylsulfanyl)phenyl]propanamide (CAS 929973-61-5) is a chemical compound with the molecular formula C10H10ClF2NOS and a molecular weight of 265.71 g/mol. IUPAC name: 2-chloro-N-[4-(difluoromethylsulfanyl)phenyl]propanamide. InChIKey: RUOUYDZMQZBPCH-UHFFFAOYSA-N.
| Molecular formula | C10H10ClF2NOS |
|---|---|
| Molecular weight | 265.71 g/mol |
| IUPAC name | 2-chloro-N-[4-(difluoromethylsulfanyl)phenyl]propanamide |
| InChIKey | RUOUYDZMQZBPCH-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC=C(C=C1)SC(F)F)Cl |
Computed by PubChem (NCBI)