CAS 929974-83-4 appears in our catalog under these names: 1-Phenyl-5-(thiophen-2-yl)-1H-1,2,4-triazole-3-carboxylic acid, 95%, 1-Phenyl-5-(thiophen-2-yl)-1H-1,2,4-triazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxylic acid (CAS 929974-83-4) is a chemical compound with the molecular formula C13H9N3O2S and a molecular weight of 271.30 g/mol. IUPAC name: 1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxylic acid. InChIKey: AAGASLMAJLNZGQ-UHFFFAOYSA-N.
| Molecular formula | C13H9N3O2S |
|---|---|
| Molecular weight | 271.30 g/mol |
| IUPAC name | 1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxylic acid |
| InChIKey | AAGASLMAJLNZGQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=NC(=N2)C(=O)O)C3=CC=CS3 |
Computed by PubChem (NCBI)