Products 929975-32-6
CAS 929975-32-6 appears in our catalog under these names: 4,4,4-Trifluoro-3-(2-furyl)-3-hydroxybutanenitrile, 95%, 4,4,4-Trifluoro-3-(furan-2-yl)-3-hydroxybutanenitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
4,4,4-trifluoro-3-(furan-2-yl)-3-hydroxybutanenitrile (CAS 929975-32-6) is a chemical compound with the molecular formula C8H6F3NO2 and a molecular weight of 205.13 g/mol. IUPAC name: 4,4,4-trifluoro-3-(furan-2-yl)-3-hydroxybutanenitrile. InChIKey: CJGDOTCKAOBEIY-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO2 |
|---|---|
| Molecular weight | 205.13 g/mol |
| IUPAC name | 4,4,4-trifluoro-3-(furan-2-yl)-3-hydroxybutanenitrile |
| InChIKey | CJGDOTCKAOBEIY-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(CC#N)(C(F)(F)F)O |
Computed by PubChem (NCBI)