CAS 929975-84-8 is the registry number for 2-Bromo-6-tert-butylimidazo(2,1-b)(1,3,4)thiadiazole, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-bromo-6-tert-butylimidazo[2,1-b][1,3,4]thiadiazole (CAS 929975-84-8) is a chemical compound with the molecular formula C8H10BrN3S and a molecular weight of 260.16 g/mol. IUPAC name: 2-bromo-6-tert-butylimidazo[2,1-b][1,3,4]thiadiazole. InChIKey: VLHVCWNJFKLULZ-UHFFFAOYSA-N.
| Molecular formula | C8H10BrN3S |
|---|---|
| Molecular weight | 260.16 g/mol |
| IUPAC name | 2-bromo-6-tert-butylimidazo[2,1-b][1,3,4]thiadiazole |
| InChIKey | VLHVCWNJFKLULZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CN2C(=N1)SC(=N2)Br |
Computed by PubChem (NCBI)