Products 929976-25-0
CAS 929976-25-0 is the registry number for 3-(Aminocarbonyl)-1,2,2-trimethylcyclopentanecarboxylic acid. Offered by: Biosynth. Available pack sizes: 10g, 1g.
3-carbamoyl-1,2,2-trimethylcyclopentane-1-carboxylic acid (CAS 929976-25-0) is a chemical compound with the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. IUPAC name: 3-carbamoyl-1,2,2-trimethylcyclopentane-1-carboxylic acid. InChIKey: NPCHNZVQOCCEIW-UHFFFAOYSA-N.
| Molecular formula | C10H17NO3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 3-carbamoyl-1,2,2-trimethylcyclopentane-1-carboxylic acid |
| InChIKey | NPCHNZVQOCCEIW-UHFFFAOYSA-N |
| SMILES | CC1(C(CCC1(C)C(=O)O)C(=O)N)C |
Computed by PubChem (NCBI)