CAS 930097-17-9 appears in our catalog under these names: 9–Mesityl–10–methylacridin–10–ium iodide, 9-Mesityl-10-methylacridin-10-ium iodide 97%, 9-Mesityl-10-methylacridin-10-ium iodide, 96%, 96%, 9-MESITYL-10-METHYLACRIDIN-10-IUM IODIDE, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
10-methyl-9-(2,4,6-trimethylphenyl)acridin-10-ium iodide (CAS 930097-17-9) is a chemical compound with the molecular formula C23H22IN and a molecular weight of 439.3 g/mol. IUPAC name: 10-methyl-9-(2,4,6-trimethylphenyl)acridin-10-ium iodide. InChIKey: BUKMDCZGFAHRJC-UHFFFAOYSA-M.
| Molecular formula | C23H22IN |
|---|---|
| Molecular weight | 439.3 g/mol |
| IUPAC name | 10-methyl-9-(2,4,6-trimethylphenyl)acridin-10-ium iodide |
| InChIKey | BUKMDCZGFAHRJC-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C(=C1)C)C2=C3C=CC=CC3=[N+](C4=CC=CC=C42)C)C.[I-] |
Computed by PubChem (NCBI)