Products 93022-30-1
CAS 93022-30-1 appears in our catalog under these names: 4-Acetoxystilbene, 95%, 4-Acetoxystilbene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 50mg, 25mg.
Acetic acid;4-[(E)-2-phenylethenyl]phenol (CAS 93022-30-1) is a chemical compound with the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. IUPAC name: acetic acid;4-[(E)-2-phenylethenyl]phenol. InChIKey: NOKZKPNEEGKCNX-UHDJGPCESA-N.
| Molecular formula | C16H16O3 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | acetic acid;4-[(E)-2-phenylethenyl]phenol |
| InChIKey | NOKZKPNEEGKCNX-UHDJGPCESA-N |
| SMILES | CC(=O)O.C1=CC=C(C=C1)/C=C/C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)
Synonyms:
4-Styrylphenyl acetate