CAS 930395-84-9 is the registry number for 4-Methyl-3-{(4-(2,2,2-trifluoroethyl)piperazin-1-yl)sulfonyl}aniline, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-methyl-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]sulfonylaniline (CAS 930395-84-9) is a chemical compound with the molecular formula C13H18F3N3O2S and a molecular weight of 337.36 g/mol. IUPAC name: 4-methyl-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]sulfonylaniline. InChIKey: UUSWPGQYRLVQAD-UHFFFAOYSA-N.
| Molecular formula | C13H18F3N3O2S |
|---|---|
| Molecular weight | 337.36 g/mol |
| IUPAC name | 4-methyl-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]sulfonylaniline |
| InChIKey | UUSWPGQYRLVQAD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N)S(=O)(=O)N2CCN(CC2)CC(F)(F)F |
Computed by PubChem (NCBI)