CAS 930452-28-1 is the registry number for 4-Bromo-2-fluoro-N-(5-methylthiazol-2-yl)benzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-2-fluoro-N-(5-methyl-1,3-thiazol-2-yl)benzamide (CAS 930452-28-1) is a chemical compound with the molecular formula C11H8BrFN2OS and a molecular weight of 315.16 g/mol. IUPAC name: 4-bromo-2-fluoro-N-(5-methyl-1,3-thiazol-2-yl)benzamide. InChIKey: NSWKFRBAPSXQBP-UHFFFAOYSA-N.
| Molecular formula | C11H8BrFN2OS |
|---|---|
| Molecular weight | 315.16 g/mol |
| IUPAC name | 4-bromo-2-fluoro-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
| InChIKey | NSWKFRBAPSXQBP-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(S1)NC(=O)C2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)