CAS 930604-29-8 appears in our catalog under these names: ethyl (1,4'-bipiperidine)-4-carboxylate hydrochloride, Ethyl 1,4-Bipiperidine-4-carboxylate dihydrochloride, 95%, 95%, [1,4′-Bipiperidine]-ethyl formate (dihydrochloride), ethyl 1,4'-bipiperidine-4-carboxylate dihydrochloride, 95%, Ethyl1,4'-Bipiperidine-4-Carboxylate HCl, 95%. Offered by: Biosynth, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 1g, 2g, 5g, 100mg, 250mg, Get quote.
Ethyl 1-piperidin-4-ylpiperidine-4-carboxylate;dihydrochloride (CAS 930604-29-8) is a chemical compound with the molecular formula C13H26Cl2N2O2 and a molecular weight of 313.3 g/mol. IUPAC name: ethyl 1-piperidin-4-ylpiperidine-4-carboxylate;dihydrochloride. InChIKey: GCLPMHPBTNQQCJ-UHFFFAOYSA-N.
| Molecular formula | C13H26Cl2N2O2 |
|---|---|
| Molecular weight | 313.3 g/mol |
| IUPAC name | ethyl 1-piperidin-4-ylpiperidine-4-carboxylate;dihydrochloride |
| InChIKey | GCLPMHPBTNQQCJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(CC1)C2CCNCC2.Cl.Cl |
Computed by PubChem (NCBI)