CAS 93076-98-3 appears in our catalog under these names: R 59-022 hydrochloride, 98%, 98%, R 59-022 HCl, 98%, R 59-022 hydrochloride/ 97.7% (existing batch purity), R 59–022 hydrochloride, R 59-022 (hydrochloride), 98.88%. Offered by: Chemat, Ambeed, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 1mg, 100mg, 500mg, 25 mg.
6-[2-[4-[(4-fluorophenyl)-phenylmethylidene]piperidin-1-yl]ethyl]-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one;hydrochloride (CAS 93076-98-3) is a chemical compound with the molecular formula C27H27ClFN3OS and a molecular weight of 496.0 g/mol. IUPAC name: 6-[2-[4-[(4-fluorophenyl)-phenylmethylidene]piperidin-1-yl]ethyl]-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one;hydrochloride. InChIKey: APNKGVNEUKASGR-UHFFFAOYSA-N.
| Molecular formula | C27H27ClFN3OS |
|---|---|
| Molecular weight | 496.0 g/mol |
| IUPAC name | 6-[2-[4-[(4-fluorophenyl)-phenylmethylidene]piperidin-1-yl]ethyl]-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one;hydrochloride |
| InChIKey | APNKGVNEUKASGR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N2C=CSC2=N1)CCN3CCC(=C(C4=CC=CC=C4)C5=CC=C(C=C5)F)CC3.Cl |
Computed by PubChem (NCBI)