Products 930779-69-4
CAS 930779-69-4 is the registry number for 2,6-difluoro-3-(trimethylsilyl)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,6-difluoro-3-trimethylsilylbenzoic acid (CAS 930779-69-4) is a chemical compound with the molecular formula C10H12F2O2Si and a molecular weight of 230.28 g/mol. IUPAC name: 2,6-difluoro-3-trimethylsilylbenzoic acid. InChIKey: MUIYZULQLLCQAC-UHFFFAOYSA-N.
| Molecular formula | C10H12F2O2Si |
|---|---|
| Molecular weight | 230.28 g/mol |
| IUPAC name | 2,6-difluoro-3-trimethylsilylbenzoic acid |
| InChIKey | MUIYZULQLLCQAC-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=C(C(=C(C=C1)F)C(=O)O)F |
Computed by PubChem (NCBI)