CAS 1936210-97-7 is the registry number for (2,2-Difluorobenzo[d][1,3]dioxol-5-yl)trimethylsilane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,2-difluoro-1,3-benzodioxol-5-yl)-trimethylsilane (CAS 1936210-97-7) is a chemical compound with the molecular formula C10H12F2O2Si and a molecular weight of 230.28 g/mol. IUPAC name: (2,2-difluoro-1,3-benzodioxol-5-yl)-trimethylsilane. InChIKey: PLQLRKQUAVQDHN-UHFFFAOYSA-N.
| Molecular formula | C10H12F2O2Si |
|---|---|
| Molecular weight | 230.28 g/mol |
| IUPAC name | (2,2-difluoro-1,3-benzodioxol-5-yl)-trimethylsilane |
| InChIKey | PLQLRKQUAVQDHN-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CC2=C(C=C1)OC(O2)(F)F |
Computed by PubChem (NCBI)