CAS 930870-07-8 is the registry number for N-(5-Methyl-1,3,4-thiadiazol-2-yl)-1H-benzo[d]imidazole-5-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(5-methyl-1,3,4-thiadiazol-2-yl)-3H-benzimidazole-5-carboxamide (CAS 930870-07-8) is a chemical compound with the molecular formula C11H9N5OS and a molecular weight of 259.29 g/mol. IUPAC name: N-(5-methyl-1,3,4-thiadiazol-2-yl)-3H-benzimidazole-5-carboxamide. InChIKey: ISJICMSOFJNYCW-UHFFFAOYSA-N.
| Molecular formula | C11H9N5OS |
|---|---|
| Molecular weight | 259.29 g/mol |
| IUPAC name | N-(5-methyl-1,3,4-thiadiazol-2-yl)-3H-benzimidazole-5-carboxamide |
| InChIKey | ISJICMSOFJNYCW-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(S1)NC(=O)C2=CC3=C(C=C2)N=CN3 |
Computed by PubChem (NCBI)