CAS 930978-46-4 is the registry number for N-(2-Fluorobenzyl)tetrazolo[1,5-b]pyridazin-6-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(2-fluorophenyl)methyl]tetrazolo[1,5-b]pyridazin-6-amine (CAS 930978-46-4) is a chemical compound with the molecular formula C11H9FN6 and a molecular weight of 244.23 g/mol. IUPAC name: N-[(2-fluorophenyl)methyl]tetrazolo[1,5-b]pyridazin-6-amine. InChIKey: VGQAFQPHLGJJHV-UHFFFAOYSA-N.
| Molecular formula | C11H9FN6 |
|---|---|
| Molecular weight | 244.23 g/mol |
| IUPAC name | N-[(2-fluorophenyl)methyl]tetrazolo[1,5-b]pyridazin-6-amine |
| InChIKey | VGQAFQPHLGJJHV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNC2=NN3C(=NN=N3)C=C2)F |
Computed by PubChem (NCBI)