CAS 930982-69-7 is the registry number for 3-(2,4-Difluorophenyl)thieno[3,2-d]pyrimidine-2,4(1h,3h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(2,4-difluorophenyl)-1H-thieno[3,2-d]pyrimidine-2,4-dione (CAS 930982-69-7) is a chemical compound with the molecular formula C12H6F2N2O2S and a molecular weight of 280.25 g/mol. IUPAC name: 3-(2,4-difluorophenyl)-1H-thieno[3,2-d]pyrimidine-2,4-dione. InChIKey: JRZULTYQKNXWIY-UHFFFAOYSA-N.
| Molecular formula | C12H6F2N2O2S |
|---|---|
| Molecular weight | 280.25 g/mol |
| IUPAC name | 3-(2,4-difluorophenyl)-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| InChIKey | JRZULTYQKNXWIY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)N2C(=O)C3=C(C=CS3)NC2=O |
Computed by PubChem (NCBI)