CAS 93101-02-1 is the registry number for W–18. Offered by: GLPBio. Available pack sizes: 1mg.
4-chloro-N-[1-[2-(4-nitrophenyl)ethyl]piperidin-2-ylidene]benzenesulfonamide (CAS 93101-02-1) is a chemical compound with the molecular formula C19H20ClN3O4S and a molecular weight of 421.9 g/mol. IUPAC name: 4-chloro-N-[1-[2-(4-nitrophenyl)ethyl]piperidin-2-ylidene]benzenesulfonamide. InChIKey: BKRSVROQVRTSND-UHFFFAOYSA-N.
| Molecular formula | C19H20ClN3O4S |
|---|---|
| Molecular weight | 421.9 g/mol |
| IUPAC name | 4-chloro-N-[1-[2-(4-nitrophenyl)ethyl]piperidin-2-ylidene]benzenesulfonamide |
| InChIKey | BKRSVROQVRTSND-UHFFFAOYSA-N |
| SMILES | C1CCN(C(=NS(=O)(=O)C2=CC=C(C=C2)Cl)C1)CCC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)