Products 93110-05-5
CAS 93110-05-5 is the registry number for 2-Chloro-3-fluorophenyl isocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-chloro-1-fluoro-3-isocyanatobenzene (CAS 93110-05-5) is a chemical compound with the molecular formula C7H3ClFNO and a molecular weight of 171.55 g/mol. IUPAC name: 2-chloro-1-fluoro-3-isocyanatobenzene. InChIKey: HEWWJMANSDJYAA-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO |
|---|---|
| Molecular weight | 171.55 g/mol |
| IUPAC name | 2-chloro-1-fluoro-3-isocyanatobenzene |
| InChIKey | HEWWJMANSDJYAA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)Cl)N=C=O |
Computed by PubChem (NCBI)