CAS 931105-81-6 is the registry number for 3-Chloro-n-(2,4-difluorophenyl)pyrazine-2-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-chloro-N-(2,4-difluorophenyl)pyrazine-2-carboxamide (CAS 931105-81-6) is a chemical compound with the molecular formula C11H6ClF2N3O and a molecular weight of 269.63 g/mol. IUPAC name: 3-chloro-N-(2,4-difluorophenyl)pyrazine-2-carboxamide. InChIKey: CUJSRBPRBXLZRP-UHFFFAOYSA-N.
| Molecular formula | C11H6ClF2N3O |
|---|---|
| Molecular weight | 269.63 g/mol |
| IUPAC name | 3-chloro-N-(2,4-difluorophenyl)pyrazine-2-carboxamide |
| InChIKey | CUJSRBPRBXLZRP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)NC(=O)C2=NC=CN=C2Cl |
Computed by PubChem (NCBI)