CAS 93117-51-2 is the registry number for 1-(2-Bromoethyl)-4-aza-1-azoniabicyclo[2.2.2]octane bromide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(2-bromoethyl)-4-aza-1-azoniabicyclo[2.2.2]octane bromide (CAS 93117-51-2) is a chemical compound with the molecular formula C8H16Br2N2 and a molecular weight of 300.03 g/mol. IUPAC name: 1-(2-bromoethyl)-4-aza-1-azoniabicyclo[2.2.2]octane bromide. InChIKey: WQNFVDOOXVCXNV-UHFFFAOYSA-M.
| Molecular formula | C8H16Br2N2 |
|---|---|
| Molecular weight | 300.03 g/mol |
| IUPAC name | 1-(2-bromoethyl)-4-aza-1-azoniabicyclo[2.2.2]octane bromide |
| InChIKey | WQNFVDOOXVCXNV-UHFFFAOYSA-M |
| SMILES | C1C[N+]2(CCN1CC2)CCBr.[Br-] |
Computed by PubChem (NCBI)