Products 93117-51-2

CAS 93117-51-2 is the registry number for 1-(2-Bromoethyl)-4-aza-1-azoniabicyclo[2.2.2]octane bromide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

1-(2-bromoethyl)-4-aza-1-azoniabicyclo[2.2.2]octane bromide (CAS 93117-51-2) is a chemical compound with the molecular formula C8H16Br2N2 and a molecular weight of 300.03 g/mol. IUPAC name: 1-(2-bromoethyl)-4-aza-1-azoniabicyclo[2.2.2]octane bromide. InChIKey: WQNFVDOOXVCXNV-UHFFFAOYSA-M.

Identity
Molecular formulaC8H16Br2N2
Molecular weight300.03 g/mol
IUPAC name1-(2-bromoethyl)-4-aza-1-azoniabicyclo[2.2.2]octane bromide
InChIKeyWQNFVDOOXVCXNV-UHFFFAOYSA-M
SMILESC1C[N+]2(CCN1CC2)CCBr.[Br-]

Computed by PubChem (NCBI)