CAS 93128-04-2 appears in our catalog under these names: 4-Bromophenacyl-trifluoromethanesulfonate, 4–Bromophenacyl–trifluoromethanesulfonate. Offered by: Creative Peptides, GLPBio. Available pack sizes: 250mg, 1g.
[2-(4-bromophenyl)-2-oxoethyl] trifluoromethanesulfonate (CAS 93128-04-2) is a chemical compound with the molecular formula C9H6BrF3O4S and a molecular weight of 347.11 g/mol. IUPAC name: [2-(4-bromophenyl)-2-oxoethyl] trifluoromethanesulfonate. InChIKey: YMYKWFCLILHEJB-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O4S |
|---|---|
| Molecular weight | 347.11 g/mol |
| IUPAC name | [2-(4-bromophenyl)-2-oxoethyl] trifluoromethanesulfonate |
| InChIKey | YMYKWFCLILHEJB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)COS(=O)(=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)