Products 93131-17-0
CAS 93131-17-0 appears in our catalog under these names: Cyclohexanol-d11, Cyclohexan-d11-ol, 98 atom % D, min 98% Chemical Purity, 1-Cyclohexanol-d11. Offered by: TRC, CDN, Biosynth, MedChemExpress. Available pack sizes: 100mg, 1g, 0,5g, 1000mg, 100 mg, 1 g.
1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexan-1-ol (CAS 93131-17-0) is a chemical compound with the molecular formula C6H12O and a molecular weight of 111.23 g/mol. IUPAC name: 1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexan-1-ol. InChIKey: HPXRVTGHNJAIIH-KAFHOZLVSA-N.
| Molecular formula | C6H12O |
|---|---|
| Molecular weight | 111.23 g/mol |
| IUPAC name | 1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexan-1-ol |
| InChIKey | HPXRVTGHNJAIIH-KAFHOZLVSA-N |
| SMILES | [2H]C1(C(C(C(C(C1([2H])[2H])([2H])[2H])([2H])O)([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)