CAS 93133-76-7 appears in our catalog under these names: D-Myo-Inositol 1,3,4-tris(phosphate), 97%, D-myo-Inositol 1,3,4-tris-phosphate. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
(2,3,5-trihydroxy-4,6-diphosphonooxycyclohexyl) dihydrogen phosphate (CAS 93133-76-7) is a chemical compound with the molecular formula C6H15O15P3 and a molecular weight of 420.10 g/mol. IUPAC name: (2,3,5-trihydroxy-4,6-diphosphonooxycyclohexyl) dihydrogen phosphate. InChIKey: MMWCIQZXVOZEGG-UHFFFAOYSA-N.
| Molecular formula | C6H15O15P3 |
|---|---|
| Molecular weight | 420.10 g/mol |
| IUPAC name | (2,3,5-trihydroxy-4,6-diphosphonooxycyclohexyl) dihydrogen phosphate |
| InChIKey | MMWCIQZXVOZEGG-UHFFFAOYSA-N |
| SMILES | C1(C(C(C(C(C1OP(=O)(O)O)O)OP(=O)(O)O)OP(=O)(O)O)O)O |
Computed by PubChem (NCBI)