CAS 931359-26-1 is the registry number for tert-Butyl 2-(4-chlorophenyl)-3-oxo-1,4,8-triazaspiro[4.5]dec-1-ene-8-carboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl 3-(4-chlorophenyl)-2-oxo-1,4,8-triazaspiro[4.5]dec-3-ene-8-carboxylate (CAS 931359-26-1) is a chemical compound with the molecular formula C18H22ClN3O3 and a molecular weight of 363.8 g/mol. IUPAC name: tert-butyl 3-(4-chlorophenyl)-2-oxo-1,4,8-triazaspiro[4.5]dec-3-ene-8-carboxylate. InChIKey: JFWQIYABICLKML-UHFFFAOYSA-N.
| Molecular formula | C18H22ClN3O3 |
|---|---|
| Molecular weight | 363.8 g/mol |
| IUPAC name | tert-butyl 3-(4-chlorophenyl)-2-oxo-1,4,8-triazaspiro[4.5]dec-3-ene-8-carboxylate |
| InChIKey | JFWQIYABICLKML-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)NC(=O)C(=N2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)