CAS 931399-20-1 is the registry number for 1-(2-Cyclopropylethyl)-6-fluoro-1,2-dihydro-4-hydroxy-2-oxo-3-quinolinecarboxylic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 100mg, 10mg.
Ethyl 1-(2-cyclopropylethyl)-6-fluoro-4-hydroxy-2-oxoquinoline-3-carboxylate (CAS 931399-20-1) is a chemical compound with the molecular formula C17H18FNO4 and a molecular weight of 319.33 g/mol. IUPAC name: ethyl 1-(2-cyclopropylethyl)-6-fluoro-4-hydroxy-2-oxoquinoline-3-carboxylate. InChIKey: QONQNYSCVSETRG-UHFFFAOYSA-N.
| Molecular formula | C17H18FNO4 |
|---|---|
| Molecular weight | 319.33 g/mol |
| IUPAC name | ethyl 1-(2-cyclopropylethyl)-6-fluoro-4-hydroxy-2-oxoquinoline-3-carboxylate |
| InChIKey | QONQNYSCVSETRG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(C=CC(=C2)F)N(C1=O)CCC3CC3)O |
Computed by PubChem (NCBI)