CAS 931593-20-3 appears in our catalog under these names: 2,4-Difluoro-N-8-quinolinylbenzenesulfonamide, 97%, 97%, 2,4-DIFLUORO-N-(QUINOLIN-8-YL)BENZENE-1-SULFONAMIDE, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg.
2,4-difluoro-N-quinolin-8-ylbenzenesulfonamide (CAS 931593-20-3) is a chemical compound with the molecular formula C15H10F2N2O2S and a molecular weight of 320.3 g/mol. IUPAC name: 2,4-difluoro-N-quinolin-8-ylbenzenesulfonamide. InChIKey: UOYLCZKDRHYEBX-UHFFFAOYSA-N.
| Molecular formula | C15H10F2N2O2S |
|---|---|
| Molecular weight | 320.3 g/mol |
| IUPAC name | 2,4-difluoro-N-quinolin-8-ylbenzenesulfonamide |
| InChIKey | UOYLCZKDRHYEBX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)NS(=O)(=O)C3=C(C=C(C=C3)F)F)N=CC=C2 |
Computed by PubChem (NCBI)