Products 931621-75-9
CAS 931621-75-9 is the registry number for N-(7-Chloro-2,3-dihydro-1,4-benzodioxin-6-yl)-4-fluorobenzamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-4-fluorobenzamide (CAS 931621-75-9) is a chemical compound with the molecular formula C15H11ClFNO3 and a molecular weight of 307.70 g/mol. IUPAC name: N-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-4-fluorobenzamide. InChIKey: YGYWMJBHAIKDQN-UHFFFAOYSA-N.
| Molecular formula | C15H11ClFNO3 |
|---|---|
| Molecular weight | 307.70 g/mol |
| IUPAC name | N-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-4-fluorobenzamide |
| InChIKey | YGYWMJBHAIKDQN-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C(=C2)Cl)NC(=O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)