CAS 931625-48-8 is the registry number for (3-Bromophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)methanone, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-bromophenyl)-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methanone (CAS 931625-48-8) is a chemical compound with the molecular formula C14H12BrNOS and a molecular weight of 322.22 g/mol. IUPAC name: (3-bromophenyl)-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methanone. InChIKey: PVTGVGVEQUCLKK-UHFFFAOYSA-N.
| Molecular formula | C14H12BrNOS |
|---|---|
| Molecular weight | 322.22 g/mol |
| IUPAC name | (3-bromophenyl)-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methanone |
| InChIKey | PVTGVGVEQUCLKK-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1SC=C2)C(=O)C3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)