Products 931927-97-8

CAS 931927-97-8 is the registry number for 3-(4-Trifluoromethylbenzyl)-1,3-dihydroindol-2-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-dihydroindol-2-one (CAS 931927-97-8) is a chemical compound with the molecular formula C16H12F3NO and a molecular weight of 291.27 g/mol. IUPAC name: 3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-dihydroindol-2-one. InChIKey: XRYBMGWCUXYRJI-UHFFFAOYSA-N.

Identity
Molecular formulaC16H12F3NO
Molecular weight291.27 g/mol
IUPAC name3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-dihydroindol-2-one
InChIKeyXRYBMGWCUXYRJI-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(C(=O)N2)CC3=CC=C(C=C3)C(F)(F)F

Computed by PubChem (NCBI)