CAS 931927-97-8 is the registry number for 3-(4-Trifluoromethylbenzyl)-1,3-dihydroindol-2-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-dihydroindol-2-one (CAS 931927-97-8) is a chemical compound with the molecular formula C16H12F3NO and a molecular weight of 291.27 g/mol. IUPAC name: 3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-dihydroindol-2-one. InChIKey: XRYBMGWCUXYRJI-UHFFFAOYSA-N.
| Molecular formula | C16H12F3NO |
|---|---|
| Molecular weight | 291.27 g/mol |
| IUPAC name | 3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-dihydroindol-2-one |
| InChIKey | XRYBMGWCUXYRJI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C(=O)N2)CC3=CC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)