CAS 932-69-4 appears in our catalog under these names: Cobalt(ii) benzoate, 95%, Cobalt(II) benzoate , Cobaltous benzoate, Cobalt(II) benzoate 97%, Cobalt(ii) benzoate, 98%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed, Fluorochem. Available pack sizes: 10g, 250g, 50g, 500g, 25g, 1g, 5g.
Cobalt(2+) dibenzoate (CAS 932-69-4) is a chemical compound with the molecular formula C14H10CoO4 and a molecular weight of 301.16 g/mol. IUPAC name: cobalt(2+) dibenzoate. InChIKey: GAYAMOAYBXKUII-UHFFFAOYSA-L.
| Molecular formula | C14H10CoO4 |
|---|---|
| Molecular weight | 301.16 g/mol |
| IUPAC name | cobalt(2+) dibenzoate |
| InChIKey | GAYAMOAYBXKUII-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)C(=O)[O-].C1=CC=C(C=C1)C(=O)[O-].[Co+2] |
Computed by PubChem (NCBI)