CAS 93206-60-1 is the registry number for (S)-(-)-3-hydroxy-3-methyl-4,4,4-trichlorobutyricbeta-lactone, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S)-4-methyl-4-(trichloromethyl)oxetan-2-one (CAS 93206-60-1) is a chemical compound with the molecular formula C5H5Cl3O2 and a molecular weight of 203.45 g/mol. IUPAC name: (4S)-4-methyl-4-(trichloromethyl)oxetan-2-one. InChIKey: MIYJBPXTAZJPGX-BYPYZUCNSA-N.
| Molecular formula | C5H5Cl3O2 |
|---|---|
| Molecular weight | 203.45 g/mol |
| IUPAC name | (4S)-4-methyl-4-(trichloromethyl)oxetan-2-one |
| InChIKey | MIYJBPXTAZJPGX-BYPYZUCNSA-N |
| SMILES | C[C@]1(CC(=O)O1)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)