CAS 932108-20-8 is the registry number for RSV604 (R enantiomer), 77.97%. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(2-fluorophenyl)-3-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]urea (CAS 932108-20-8) is a chemical compound with the molecular formula C22H17FN4O2 and a molecular weight of 388.4 g/mol. IUPAC name: 1-(2-fluorophenyl)-3-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]urea. InChIKey: MTPVBMVUENFFLL-FQEVSTJZSA-N.
| Molecular formula | C22H17FN4O2 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | 1-(2-fluorophenyl)-3-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]urea |
| InChIKey | MTPVBMVUENFFLL-FQEVSTJZSA-N |
| SMILES | C1=CC=C(C=C1)C2=N[C@H](C(=O)NC3=CC=CC=C32)NC(=O)NC4=CC=CC=C4F |
Computed by PubChem (NCBI)