CAS 93221-74-0 is the registry number for (2S-trans)-3-Methyl-3-(4-methyl-3-pentenyl)-oxiranemethanol Methanesulfonate. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
[(2S,3S)-3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]methyl methanesulfonate (CAS 93221-74-0) is a chemical compound with the molecular formula C11H20O4S and a molecular weight of 248.34 g/mol. IUPAC name: [(2S,3S)-3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]methyl methanesulfonate. InChIKey: GGQOHQOIVZQPCU-QWRGUYRKSA-N.
| Molecular formula | C11H20O4S |
|---|---|
| Molecular weight | 248.34 g/mol |
| IUPAC name | [(2S,3S)-3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]methyl methanesulfonate |
| InChIKey | GGQOHQOIVZQPCU-QWRGUYRKSA-N |
| SMILES | CC(=CCC[C@]1([C@@H](O1)COS(=O)(=O)C)C)C |
Computed by PubChem (NCBI)