CAS 932303-49-6 is the registry number for Ethyl 3-(N-(3,4-difluorophenyl)sulfamoyl)benzo[b]thiophene-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-[(3,4-difluorophenyl)sulfamoyl]-1-benzothiophene-2-carboxylate (CAS 932303-49-6) is a chemical compound with the molecular formula C17H13F2NO4S2 and a molecular weight of 397.4 g/mol. IUPAC name: ethyl 3-[(3,4-difluorophenyl)sulfamoyl]-1-benzothiophene-2-carboxylate. InChIKey: PCWGONLYKAOLGL-UHFFFAOYSA-N.
| Molecular formula | C17H13F2NO4S2 |
|---|---|
| Molecular weight | 397.4 g/mol |
| IUPAC name | ethyl 3-[(3,4-difluorophenyl)sulfamoyl]-1-benzothiophene-2-carboxylate |
| InChIKey | PCWGONLYKAOLGL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=CC=CC=C2S1)S(=O)(=O)NC3=CC(=C(C=C3)F)F |
Computed by PubChem (NCBI)