CAS 932378-94-4 appears in our catalog under these names: 3,5-Bis(ethoxycarbonyl)phenylboronic acid, 95%, 3,5–bis(ethoxycarbonyl)phenylboronicacid, [3,5-Bis(ethoxycarbonyl)phenyl]boronic Acid (contains varying amounts of Anhydride), (3,5-bis(ethoxycarbonyl)phenyl)boronic acid 95%, (3,5-Bis(ethoxycarbonyl)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 200mg, 10g, 25g, 100mg, 15g.
[3,5-bis(ethoxycarbonyl)phenyl]boronic acid (CAS 932378-94-4) is a chemical compound with the molecular formula C12H15BO6 and a molecular weight of 266.06 g/mol. IUPAC name: [3,5-bis(ethoxycarbonyl)phenyl]boronic acid. InChIKey: XXBGYFGJSMAOSZ-UHFFFAOYSA-N.
| Molecular formula | C12H15BO6 |
|---|---|
| Molecular weight | 266.06 g/mol |
| IUPAC name | [3,5-bis(ethoxycarbonyl)phenyl]boronic acid |
| InChIKey | XXBGYFGJSMAOSZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(=O)OCC)C(=O)OCC)(O)O |
Computed by PubChem (NCBI)