CAS 93246-54-9 appears in our catalog under these names: 3-Fluoro-4-(pyrrolidin-1-yl)aniline, 98%, (3-Fluoro-4-pyrrolidin-1-ylphenyl)amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
3-fluoro-4-pyrrolidin-1-ylaniline (CAS 93246-54-9) is a chemical compound with the molecular formula C10H13FN2 and a molecular weight of 180.22 g/mol. IUPAC name: 3-fluoro-4-pyrrolidin-1-ylaniline. InChIKey: NOTAKFXSHAJNDN-UHFFFAOYSA-N.
| Molecular formula | C10H13FN2 |
|---|---|
| Molecular weight | 180.22 g/mol |
| IUPAC name | 3-fluoro-4-pyrrolidin-1-ylaniline |
| InChIKey | NOTAKFXSHAJNDN-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=C(C=C(C=C2)N)F |
Computed by PubChem (NCBI)