Products 932700-83-9
CAS 932700-83-9 is the registry number for 1,1-Dimethylethyl 4-[(2-amino-5-chlorophenyl)amino]-1-piperidinecarboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl 4-(2-amino-5-chloroanilino)piperidine-1-carboxylate (CAS 932700-83-9) is a chemical compound with the molecular formula C16H24ClN3O2 and a molecular weight of 325.83 g/mol. IUPAC name: tert-butyl 4-(2-amino-5-chloroanilino)piperidine-1-carboxylate. InChIKey: MCEVVYDLRADCDT-UHFFFAOYSA-N.
| Molecular formula | C16H24ClN3O2 |
|---|---|
| Molecular weight | 325.83 g/mol |
| IUPAC name | tert-butyl 4-(2-amino-5-chloroanilino)piperidine-1-carboxylate |
| InChIKey | MCEVVYDLRADCDT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)NC2=C(C=CC(=C2)Cl)N |
Computed by PubChem (NCBI)