CAS 932711-54-1 appears in our catalog under these names: 3-(2-(2,4-Dichlorophenyl)-2-(2,3-dihydroxypropoxy)ethyl)imidazolidine-2,4-dione, Imazalil Metabolite FK-772, Imazalil Metabolite FK-772, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, HPC Standards. Available pack sizes: 100mg, 1x10mg, 1x1ml.
3-[2-(2,4-dichlorophenyl)-2-(2,3-dihydroxypropoxy)ethyl]imidazolidine-2,4-dione (CAS 932711-54-1) is a chemical compound with the molecular formula C14H16Cl2N2O5 and a molecular weight of 363.2 g/mol. IUPAC name: 3-[2-(2,4-dichlorophenyl)-2-(2,3-dihydroxypropoxy)ethyl]imidazolidine-2,4-dione. InChIKey: SPULEQRPBJYQTB-UHFFFAOYSA-N.
| Molecular formula | C14H16Cl2N2O5 |
|---|---|
| Molecular weight | 363.2 g/mol |
| IUPAC name | 3-[2-(2,4-dichlorophenyl)-2-(2,3-dihydroxypropoxy)ethyl]imidazolidine-2,4-dione |
| InChIKey | SPULEQRPBJYQTB-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)N1)CC(C2=C(C=C(C=C2)Cl)Cl)OCC(CO)O |
Computed by PubChem (NCBI)