Products 932738-80-2
CAS 932738-80-2 appears in our catalog under these names: 4–(6–Chloropyrimidin–4–yl)–N–methylthiazol–2–amine, 4-(6-Chloropyrimidin-4-yl)-N-methylthiazol-2-amine, 95%. Offered by: GLPBio, Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-(6-chloropyrimidin-4-yl)-N-methyl-1,3-thiazol-2-amine (CAS 932738-80-2) is a chemical compound with the molecular formula C8H7ClN4S and a molecular weight of 226.69 g/mol. IUPAC name: 4-(6-chloropyrimidin-4-yl)-N-methyl-1,3-thiazol-2-amine. InChIKey: WVOKVBIEELFKFB-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4S |
|---|---|
| Molecular weight | 226.69 g/mol |
| IUPAC name | 4-(6-chloropyrimidin-4-yl)-N-methyl-1,3-thiazol-2-amine |
| InChIKey | WVOKVBIEELFKFB-UHFFFAOYSA-N |
| SMILES | CNC1=NC(=CS1)C2=CC(=NC=N2)Cl |
Computed by PubChem (NCBI)