CAS 932749-62-7 appears in our catalog under these names: Histone Acetyltransferase Inhibitor II, Histone Acetyltransferase Inhibitor II/ 97.13% (existing batch purity), HAT Inhibitor II, Histone Acetyltransferase In 1PC X 10MG, 2,6-Bis(3-bromo-4-hydroxybenzylidene)cyclohexan-1-one, 99%, 99%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 10mM/1mL, 100 mg.
(2E,6E)-2,6-bis[(3-bromo-4-hydroxyphenyl)methylidene]cyclohexan-1-one (CAS 932749-62-7) is a chemical compound with the molecular formula C20H16Br2O3 and a molecular weight of 464.1 g/mol. IUPAC name: (2E,6E)-2,6-bis[(3-bromo-4-hydroxyphenyl)methylidene]cyclohexan-1-one. InChIKey: YOLKEKNTCBWPSD-VOMDNODZSA-N.
| Molecular formula | C20H16Br2O3 |
|---|---|
| Molecular weight | 464.1 g/mol |
| IUPAC name | (2E,6E)-2,6-bis[(3-bromo-4-hydroxyphenyl)methylidene]cyclohexan-1-one |
| InChIKey | YOLKEKNTCBWPSD-VOMDNODZSA-N |
| SMILES | C1C/C(=C\C2=CC(=C(C=C2)O)Br)/C(=O)/C(=C/C3=CC(=C(C=C3)O)Br)/C1 |
Computed by PubChem (NCBI)