CAS 932780-89-7 is the registry number for N-Ethyl-2,4-dimethylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-ethyl-2,4-dimethylbenzamide (CAS 932780-89-7) is a chemical compound with the molecular formula C11H15NO and a molecular weight of 177.24 g/mol. IUPAC name: N-ethyl-2,4-dimethylbenzamide. InChIKey: HAQYKUSCMCCAAG-UHFFFAOYSA-N.
| Molecular formula | C11H15NO |
|---|---|
| Molecular weight | 177.24 g/mol |
| IUPAC name | N-ethyl-2,4-dimethylbenzamide |
| InChIKey | HAQYKUSCMCCAAG-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1=C(C=C(C=C1)C)C |
Computed by PubChem (NCBI)