CAS 933034-89-0 appears in our catalog under these names: 8-Bromo-6-chloroimidazo[1,2-b]pyridazine hydrochloride, 95%, 8-Bromo-6-chloroimidazo(1,2-b)pyridazine hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
8-bromo-6-chloroimidazo[1,2-b]pyridazine;hydrochloride (CAS 933034-89-0) is a chemical compound with the molecular formula C6H4BrCl2N3 and a molecular weight of 268.92 g/mol. IUPAC name: 8-bromo-6-chloroimidazo[1,2-b]pyridazine;hydrochloride. InChIKey: KVJJRUBYJAUYIT-UHFFFAOYSA-N.
| Molecular formula | C6H4BrCl2N3 |
|---|---|
| Molecular weight | 268.92 g/mol |
| IUPAC name | 8-bromo-6-chloroimidazo[1,2-b]pyridazine;hydrochloride |
| InChIKey | KVJJRUBYJAUYIT-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=N1)C(=CC(=N2)Cl)Br.Cl |
Computed by PubChem (NCBI)