Products 933254-00-3

CAS 933254-00-3 is the registry number for 4-(5-(N,N-Diethylsulfamoyl)-1H-benzo[d][1,2,3]triazol-1-yl)butanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[5-(diethylsulfamoyl)benzotriazol-1-yl]butanoic acid (CAS 933254-00-3) is a chemical compound with the molecular formula C14H20N4O4S and a molecular weight of 340.40 g/mol. IUPAC name: 4-[5-(diethylsulfamoyl)benzotriazol-1-yl]butanoic acid. InChIKey: WLGHDDVTXVNQQG-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20N4O4S
Molecular weight340.40 g/mol
IUPAC name4-[5-(diethylsulfamoyl)benzotriazol-1-yl]butanoic acid
InChIKeyWLGHDDVTXVNQQG-UHFFFAOYSA-N
SMILESCCN(CC)S(=O)(=O)C1=CC2=C(C=C1)N(N=N2)CCCC(=O)O

Computed by PubChem (NCBI)