CAS 93342-77-9 appears in our catalog under these names: 2,3-Dibromo-1,4-diphenylbutane, 95%, 2,3-Dibromo-1,4-diphenylbutane, 2,3-Dibromo-1,4-diphenylbutane, min. 95 %, 100 mg, 2,3-Dibromo-1,4-diphenylbutane, min. 95 %, 250 mg, 2,3-Dibromo-1,4-diphenylbutane, min. 95 %, 500 mg. Offered by: Combi-blocks, TRC, Biosynth, Roth. Available pack sizes: 100mg, 1g, 250mg, 500mg, 1000mg.
(2,3-dibromo-4-phenylbutyl)benzene (CAS 93342-77-9) is a chemical compound with the molecular formula C16H16Br2 and a molecular weight of 368.11 g/mol. IUPAC name: (2,3-dibromo-4-phenylbutyl)benzene. InChIKey: JAABKEXJJBGULF-UHFFFAOYSA-N.
| Molecular formula | C16H16Br2 |
|---|---|
| Molecular weight | 368.11 g/mol |
| IUPAC name | (2,3-dibromo-4-phenylbutyl)benzene |
| InChIKey | JAABKEXJJBGULF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(CC2=CC=CC=C2)Br)Br |
Computed by PubChem (NCBI)