CAS 933443-26-6 appears in our catalog under these names: Fosfomycin Trometamol Impurity 16, cis-Propenylphosphonic Acid (R)-(+)-Alpha-Methylbenzylamine Salt, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg, 50mg.
(1R)-1-phenylethanamine;[(Z)-prop-1-enyl]phosphonic acid (CAS 933443-26-6) is a chemical compound with the molecular formula C11H18NO3P and a molecular weight of 243.24 g/mol. IUPAC name: (1R)-1-phenylethanamine;[(Z)-prop-1-enyl]phosphonic acid. InChIKey: CUMLAIKEAHWEFG-POMABLRUSA-N.
| Molecular formula | C11H18NO3P |
|---|---|
| Molecular weight | 243.24 g/mol |
| IUPAC name | (1R)-1-phenylethanamine;[(Z)-prop-1-enyl]phosphonic acid |
| InChIKey | CUMLAIKEAHWEFG-POMABLRUSA-N |
| SMILES | C/C=C\P(=O)(O)O.C[C@H](C1=CC=CC=C1)N |
Computed by PubChem (NCBI)