CAS 933551-28-1 is the registry number for 3-(3,5-Dibromo-1H-1,2,4-triazol-1-yl)propanamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,5-dibromo-1,2,4-triazol-1-yl)propanamide (CAS 933551-28-1) is a chemical compound with the molecular formula C5H6Br2N4O and a molecular weight of 297.94 g/mol. IUPAC name: 3-(3,5-dibromo-1,2,4-triazol-1-yl)propanamide. InChIKey: LFWYMISETXJMMM-UHFFFAOYSA-N.
| Molecular formula | C5H6Br2N4O |
|---|---|
| Molecular weight | 297.94 g/mol |
| IUPAC name | 3-(3,5-dibromo-1,2,4-triazol-1-yl)propanamide |
| InChIKey | LFWYMISETXJMMM-UHFFFAOYSA-N |
| SMILES | C(CN1C(=NC(=N1)Br)Br)C(=O)N |
Computed by PubChem (NCBI)