Products 933667-23-3
CAS 933667-23-3 is the registry number for Tyk2-IN-22. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-chlorophenyl)-5-(morpholin-4-ylmethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (CAS 933667-23-3) is a chemical compound with the molecular formula C16H16ClN5O2 and a molecular weight of 345.78 g/mol. IUPAC name: 2-(4-chlorophenyl)-5-(morpholin-4-ylmethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one. InChIKey: RZMOUUKYNPBBBH-UHFFFAOYSA-N.
| Molecular formula | C16H16ClN5O2 |
|---|---|
| Molecular weight | 345.78 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-5-(morpholin-4-ylmethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| InChIKey | RZMOUUKYNPBBBH-UHFFFAOYSA-N |
| SMILES | C1COCCN1CC2=CC(=O)N3C(=N2)N=C(N3)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)
Synonyms:
Tyk2-IN-22, orb2814223