Products 933687-06-0

CAS 933687-06-0 is the registry number for 4-Chloro-2-methylthiazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-chloro-2-methyl-1,3-thiazole-5-carboxylic acid (CAS 933687-06-0) is a chemical compound with the molecular formula C5H4ClNO2S and a molecular weight of 177.61 g/mol. IUPAC name: 4-chloro-2-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: DPJZGYPTUPSVHZ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4ClNO2S
Molecular weight177.61 g/mol
IUPAC name4-chloro-2-methyl-1,3-thiazole-5-carboxylic acid
InChIKeyDPJZGYPTUPSVHZ-UHFFFAOYSA-N
SMILESCC1=NC(=C(S1)C(=O)O)Cl

Computed by PubChem (NCBI)