Products 933694-57-6
CAS 933694-57-6 appears in our catalog under these names: 1,3-Dihydro-2-benzofuran-5-carboxylic acid, 95%, 1,3-Dihydroisobenzofuran-5-carboxylic acid, 97%, 1,3-dihydro-2-benzofuran-5-carboxylic acid, 1,3-DIHYDRO-2-BENZOFURAN-5-CARBOXYLIC ACID, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem, Chemat. Available pack sizes: 10g, 250mg, 1g, 5g, 0,5g, 100mg, 500mg.
1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS 933694-57-6) is a chemical compound with the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. IUPAC name: 1,3-dihydro-2-benzofuran-5-carboxylic acid. InChIKey: QQYBGVFMYNTJDJ-UHFFFAOYSA-N.
| Molecular formula | C9H8O3 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | 1,3-dihydro-2-benzofuran-5-carboxylic acid |
| InChIKey | QQYBGVFMYNTJDJ-UHFFFAOYSA-N |
| SMILES | C1C2=C(CO1)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1,3-dihydro-2-benzofuran-5-carboxylic acid, 1,3-Dihydroisobenzofuran-5-carboxylic acid, Reaxys ID: 18845050, 1,3-Dihydroisobenzofuran-5-carboxylicacid, 1,3-Dihydro-5-isobenzofurancarboxylic acid, 5-Isobenzofurancarboxylic acid, 1,3-dihydro-, 1,3-Dihydro-2-Benzofuran-5-Carboxylic Acid(WX612136)