CAS 933703-46-9 is the registry number for 7-(Aminomethyl)-1,3,4,5-tetrahydro-2H-benzo[b]azepin-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-(aminomethyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one (CAS 933703-46-9) is a chemical compound with the molecular formula C11H14N2O and a molecular weight of 190.24 g/mol. IUPAC name: 7-(aminomethyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one. InChIKey: HNTILXSHDHPMCQ-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 7-(aminomethyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| InChIKey | HNTILXSHDHPMCQ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)CN)NC(=O)C1 |
Computed by PubChem (NCBI)